C10H10N2O4S2 — CID 54242448
(2-sulfamoyl-1,3-benzothiazol-6-yl) propanoate (PubChem CID 54242448) has the molecular formula C10H10N2O4S2 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2-sulfamoyl-1,3-benzothiazol-6-yl) propanoate.
| Compound Name | (2-sulfamoyl-1,3-benzothiazol-6-yl) propanoate |
|---|---|
| PubChem CID | 54242448 |
| Molecular Formula | C10H10N2O4S2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | (2-sulfamoyl-1,3-benzothiazol-6-yl) propanoate |
| SMILES | CCC(=O)Oc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C10H10N2O4S2/c1-2-9(13)16-6-3-4-7-8(5-6)17-10(12-7)18(11,14)15/h3-5H,2H2,1H3,(H2,11,14,15) |
| InChIKey | QQYSMJUATUAFIG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|