C17H23N3O7S2 — CID 10837058
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10837058) has the molecular formula C17H23N3O7S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10837058 |
| Molecular Formula | C17H23N3O7S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)OCCOc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C17H23N3O7S2/c1-17(2,3)27-15(22)19-7-6-14(21)26-9-8-25-11-4-5-12-13(10-11)28-16(20-12)29(18,23)24/h4-5,10H,6-9H2,1-3H3,(H,19,22)(H2,18,23,24) |
| InChIKey | NKPQIELHDRDZNQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 146.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|