C20H29ClN4O11S — CID 11082357
2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl]amino]acetic acid (PubChem CID 11082357) has the molecular formula C20H29ClN4O11S and a molecular weight of 568.99 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 11082357 |
| Molecular Formula | C20H29ClN4O11S |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN(CCOCCOCCN(CC(=O)O)CC(=O)O)CC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C20H29ClN4O11S/c21-15-9-14(37(22,33)34)1-2-16(15)23-17(26)10-24(11-18(27)28)3-5-35-7-8-36-6-4-25(12-19(29)30)13-20(31)32/h1-2,9H,3-8,10-13H2,(H,23,26)(H,27,28)(H,29,30)(H,31,32)(H2,22,33,34) |
| InChIKey | AIWCQEIONROEPL-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 226.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|