C29H28ClN5O3S2 — CID 10507705
N-(2-chloro-4-sulfamoylphenyl)-2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetamide (PubChem CID 10507705) has the molecular formula C29H28ClN5O3S2 and a molecular weight of 594.16 g/mol. Its IUPAC name is N-(2-chloro-4-sulfamoylphenyl)-2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetamide.
| Compound Name | N-(2-chloro-4-sulfamoylphenyl)-2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 10507705 |
| Molecular Formula | C29H28ClN5O3S2 |
| Molecular Weight | 594.16 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | N-(2-chloro-4-sulfamoylphenyl)-2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(S(N)(=O)=O)cc1Cl)/C(N)=N/SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28ClN5O3S2/c1-35(20-27(36)33-26-18-17-24(19-25(26)30)40(32,37)38)28(31)34-39-29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-19H,20H2,1H3,(H2,31,34)(H,33,36)(H2,32,37,38) |
| InChIKey | MLAAASJROLNLHD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.16 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|