C14H20FN3O5S — CID 10808548
tert-butyl N-[2-(2-fluoro-4-sulfamoylanilino)-2-oxoethyl]-N-methylcarbamate (PubChem CID 10808548) has the molecular formula C14H20FN3O5S and a molecular weight of 361.40 g/mol. Its IUPAC name is tert-butyl N-[2-(2-fluoro-4-sulfamoylanilino)-2-oxoethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(2-fluoro-4-sulfamoylanilino)-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10808548 |
| Molecular Formula | C14H20FN3O5S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | tert-butyl N-[2-(2-fluoro-4-sulfamoylanilino)-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)Nc1ccc(S(N)(=O)=O)cc1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H20FN3O5S/c1-14(2,3)23-13(20)18(4)8-12(19)17-11-6-5-9(7-10(11)15)24(16,21)22/h5-7H,8H2,1-4H3,(H,17,19)(H2,16,21,22) |
| InChIKey | LHXNDYYUOFWNBX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |