C20H18ClN3O4S2 — CID 91433269
O-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl] N-methyl-N-naphthalen-1-ylcarbamothioate (PubChem CID 91433269) has the molecular formula C20H18ClN3O4S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is O-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl] N-methyl-N-naphthalen-1-ylcarbamothioate.
| Compound Name | O-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl] N-methyl-N-naphthalen-1-ylcarbamothioate |
|---|---|
| PubChem CID | 91433269 |
| Molecular Formula | C20H18ClN3O4S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | O-[2-(2-chloro-4-sulfamoylanilino)-2-oxoethyl] N-methyl-N-naphthalen-1-ylcarbamothioate |
| SMILES | CN(C(=S)OCC(=O)Nc1ccc(S(N)(=O)=O)cc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18ClN3O4S2/c1-24(18-8-4-6-13-5-2-3-7-15(13)18)20(29)28-12-19(25)23-17-10-9-14(11-16(17)21)30(22,26)27/h2-11H,12H2,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | JBVHKQDHXRVZBG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|