C22H28N6O10S2Zn — CID 56659116
2-[2-[carboxymethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid;zinc (PubChem CID 56659116) has the molecular formula C22H28N6O10S2Zn and a molecular weight of 666.02 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid;zinc.
| Compound Name | 2-[2-[carboxymethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid;zinc |
|---|---|
| PubChem CID | 56659116 |
| Molecular Formula | C22H28N6O10S2Zn |
| Molecular Weight | 666.02 g/mol |
| Exact Mass | 664.06 |
| IUPAC Name | 2-[2-[carboxymethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid;zinc |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN(CCN(CC(=O)O)CC(=O)Nc2ccc(S(N)(=O)=O)cc2)CC(=O)O)cc1.[Zn] |
| InChI | InChI=1S/C22H28N6O10S2.Zn/c23-39(35,36)17-5-1-15(2-6-17)25-19(29)11-27(13-21(31)32)9-10-28(14-22(33)34)12-20(30)26-16-3-7-18(8-4-16)40(24,37)38;/h1-8H,9-14H2,(H,25,29)(H,26,30)(H,31,32)(H,33,34)(H2,23,35,36)(H2,24,37,38); |
| InChIKey | IGIDVIAGTHWTOF-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 259.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.02 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|