C28H41N7O9S2 — CID 130449979
2-[2-[[2-(hexylamino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid (PubChem CID 130449979) has the molecular formula C28H41N7O9S2 and a molecular weight of 683.81 g/mol. Its IUPAC name is 2-[2-[[2-(hexylamino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid.
| Compound Name | 2-[2-[[2-(hexylamino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 130449979 |
| Molecular Formula | C28H41N7O9S2 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | 2-[2-[[2-(hexylamino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]ethyl-[2-oxo-2-(4-sulfamoylanilino)ethyl]amino]acetic acid |
| SMILES | CCCCCCNC(=O)CN(CCN(CC(=O)O)CC(=O)Nc1ccc(S(N)(=O)=O)cc1)CC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C28H41N7O9S2/c1-2-3-4-5-14-31-25(36)17-34(18-26(37)32-21-6-10-23(11-7-21)45(29,41)42)15-16-35(20-28(39)40)19-27(38)33-22-8-12-24(13-9-22)46(30,43)44/h6-13H,2-5,14-20H2,1H3,(H,31,36)(H,32,37)(H,33,38)(H,39,40)(H2,29,41,42)(H2,30,43,44) |
| InChIKey | NNOXGJWXTXIMLH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 251.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|