C15H25N3O5S2 — CID 113148292
2-[butyl(methylsulfonyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 113148292) has the molecular formula C15H25N3O5S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[butyl(methylsulfonyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[butyl(methylsulfonyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113148292 |
| Molecular Formula | C15H25N3O5S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[butyl(methylsulfonyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CCCCN(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H25N3O5S2/c1-3-4-11-18(24(2,20)21)12-15(19)17-10-9-13-5-7-14(8-6-13)25(16,22)23/h5-8H,3-4,9-12H2,1-2H3,(H,17,19)(H2,16,22,23) |
| InChIKey | SDPDKPCSCYXROG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |