C20H27N3O3S — CID 55864568
2-(N-ethyl-2,4-dimethylanilino)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 55864568) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-(N-ethyl-2,4-dimethylanilino)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(N-ethyl-2,4-dimethylanilino)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55864568 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-(N-ethyl-2,4-dimethylanilino)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CCN(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C20H27N3O3S/c1-4-23(19-10-5-15(2)13-16(19)3)14-20(24)22-12-11-17-6-8-18(9-7-17)27(21,25)26/h5-10,13H,4,11-12,14H2,1-3H3,(H,22,24)(H2,21,25,26) |
| InChIKey | CTGLRWMGDCZYQX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |