C20H22N2O4S — CID 18861355
2-(4,6-dimethyl-1-benzofuran-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 18861355) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1-benzofuran-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(4,6-dimethyl-1-benzofuran-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18861355 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-(4,6-dimethyl-1-benzofuran-3-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | Cc1cc(C)c2c(CC(=O)NCCc3ccc(S(N)(=O)=O)cc3)coc2c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-13-9-14(2)20-16(12-26-18(20)10-13)11-19(23)22-8-7-15-3-5-17(6-4-15)27(21,24)25/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,22,23)(H2,21,24,25) |
| InChIKey | RLJJHSPNBBVBCZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |