C19H20N2O5S2 — CID 34389309
2-(4-sulfamoylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 34389309) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 34389309 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)CCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H20N2O5S2/c20-28(23,24)15-10-8-14(9-11-15)25-12-13-26-19(22)7-3-6-18-21-16-4-1-2-5-17(16)27-18/h1-2,4-5,8-11H,3,6-7,12-13H2,(H2,20,23,24) |
| InChIKey | UMKUYXUPWSJCNE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|