C22H20N2O4S — CID 137182501
7-(6-aminohexanoyl)-3-(1,3-benzothiazol-2-yl)-4-hydroxychromen-2-one (PubChem CID 137182501) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 7-(6-aminohexanoyl)-3-(1,3-benzothiazol-2-yl)-4-hydroxychromen-2-one.
| Compound Name | 7-(6-aminohexanoyl)-3-(1,3-benzothiazol-2-yl)-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 137182501 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 7-(6-aminohexanoyl)-3-(1,3-benzothiazol-2-yl)-4-hydroxychromen-2-one |
| SMILES | NCCCCCC(=O)c1ccc2c(O)c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H20N2O4S/c23-11-5-1-2-7-16(25)13-9-10-14-17(12-13)28-22(27)19(20(14)26)21-24-15-6-3-4-8-18(15)29-21/h3-4,6,8-10,12,26H,1-2,5,7,11,23H2 |
| InChIKey | LLDVXNAVABLULC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|