C27H18N2O3S2 — CID 16874501
N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 16874501) has the molecular formula C27H18N2O3S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 16874501 |
| Molecular Formula | C27H18N2O3S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5-dimethylthiophen-2-yl]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | Cc1sc(NC(=O)c2cc3c(ccc4ccccc43)oc2=O)c(-c2nc3ccccc3s2)c1C |
| InChI | InChI=1S/C27H18N2O3S2/c1-14-15(2)33-26(23(14)25-28-20-9-5-6-10-22(20)34-25)29-24(30)19-13-18-17-8-4-3-7-16(17)11-12-21(18)32-27(19)31/h3-13H,1-2H3,(H,29,30) |
| InChIKey | XGNNZFCIBMMWQL-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|