C42H44N4+2 — CID 123380665
4-[2-[20-[2-[4-(dimethylamino)phenyl]ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaen-7-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 123380665) has the molecular formula C42H44N4+2 and a molecular weight of 604.84 g/mol. Its IUPAC name is 4-[2-[20-[2-[4-(dimethylamino)phenyl]ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaen-7-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[20-[2-[4-(dimethylamino)phenyl]ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaen-7-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 123380665 |
| Molecular Formula | C42H44N4+2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | 4-[2-[20-[2-[4-(dimethylamino)phenyl]ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaen-7-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=Cc2cccc3[n+]2CCCc2ccc4c(c2-3)-c2cccc(C=Cc3ccc(N(C)C)cc3)[n+]2CCC4)cc1 |
| InChI | InChI=1S/C42H44N4/c1-43(2)35-23-15-31(16-24-35)19-27-37-11-5-13-39-41-33(9-7-29-45(37)39)21-22-34-10-8-30-46-38(12-6-14-40(46)42(34)41)28-20-32-17-25-36(26-18-32)44(3)4/h5-6,11-28H,7-10,29-30H2,1-4H3/q+2 |
| InChIKey | MAJSTOHORAONCH-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|