C40H37N3+2 — CID 123733425
6-[2-(8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaen-26-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine (PubChem CID 123733425) has the molecular formula C40H37N3+2 and a molecular weight of 559.76 g/mol. Its IUPAC name is 6-[2-(8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaen-26-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine.
| Compound Name | 6-[2-(8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaen-26-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 123733425 |
| Molecular Formula | C40H37N3+2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 6-[2-(8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaen-26-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine |
| SMILES | CN(C)c1ccc2cc(C=Cc3cc4[n+](c5ccccc35)CCCc3ccc5c(c3-4)-c3cccc[n+]3CCC5)ccc2c1 |
| InChI | InChI=1S/C40H37N3/c1-41(2)34-21-20-31-25-28(14-16-32(31)26-34)15-17-33-27-38-40-30(10-8-24-43(38)36-12-4-3-11-35(33)36)19-18-29-9-7-23-42-22-6-5-13-37(42)39(29)40/h3-6,11-22,25-27H,7-10,23-24H2,1-2H3/q+2 |
| InChIKey | QRBLKKIMWFEUBK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|