C32H32N3+ — CID 126607709
4-[(1E,3E)-4-[2-(10-ethyl-6,7-dihydrobenzo[a]quinolizin-5-ium-11-yl)-4-pyridinyl]buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 126607709) has the molecular formula C32H32N3+ and a molecular weight of 458.63 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[2-(10-ethyl-6,7-dihydrobenzo[a]quinolizin-5-ium-11-yl)-4-pyridinyl]buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-4-[2-(10-ethyl-6,7-dihydrobenzo[a]quinolizin-5-ium-11-yl)-4-pyridinyl]buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 126607709 |
| Molecular Formula | C32H32N3+ |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 4-[(1E,3E)-4-[2-(10-ethyl-6,7-dihydrobenzo[a]quinolizin-5-ium-11-yl)-4-pyridinyl]buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CCc1ccc2c(c1-c1cc(/C=C/C=C/c3ccc(N(C)C)cc3)ccn1)-c1cccc[n+]1CC2 |
| InChI | InChI=1S/C32H32N3/c1-4-26-14-15-27-19-22-35-21-8-7-11-30(35)32(27)31(26)29-23-25(18-20-33-29)10-6-5-9-24-12-16-28(17-13-24)34(2)3/h5-18,20-21,23H,4,19,22H2,1-3H3/q+1/b9-5+,10-6+ |
| InChIKey | QTPVOCOJSXCSTP-NXZHAISVSA-N |
| XLogP | 6.61 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|