C36H33N3+2 — CID 139037597
4-[(1E,3E)-4-(14-methyl-7,11-diazoniatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-4-yl)buta-1,3-dienyl]-N,N-diphenylaniline (PubChem CID 139037597) has the molecular formula C36H33N3+2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(14-methyl-7,11-diazoniatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-4-yl)buta-1,3-dienyl]-N,N-diphenylaniline.
| Compound Name | 4-[(1E,3E)-4-(14-methyl-7,11-diazoniatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-4-yl)buta-1,3-dienyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 139037597 |
| Molecular Formula | C36H33N3+2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 4-[(1E,3E)-4-(14-methyl-7,11-diazoniatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-4-yl)buta-1,3-dienyl]-N,N-diphenylaniline |
| SMILES | Cc1cc[n+]2c(c1)-c1cc(/C=C/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc[n+]1CCC2 |
| InChI | InChI=1S/C36H33N3/c1-29-21-25-37-23-10-24-38-26-22-31(28-36(38)35(37)27-29)12-9-8-11-30-17-19-34(20-18-30)39(32-13-4-2-5-14-32)33-15-6-3-7-16-33/h2-9,11-22,25-28H,10,23-24H2,1H3/q+2 |
| InChIKey | LXVZRJUCSGGFLV-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|