C23H25N3+2 — CID 177455453
N,N-dimethyl-4-[(E)-2-(13-methyl-7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),3,5,11,13-hexaen-4-yl)ethenyl]aniline (PubChem CID 177455453) has the molecular formula C23H25N3+2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(13-methyl-7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),3,5,11,13-hexaen-4-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-(13-methyl-7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),3,5,11,13-hexaen-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 177455453 |
| Molecular Formula | C23H25N3+2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(13-methyl-7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-1(10),2(7),3,5,11,13-hexaen-4-yl)ethenyl]aniline |
| SMILES | Cc1cc[n+]2c(c1)-c1cc(/C=C/c3ccc(N(C)C)cc3)cc[n+]1CC2 |
| InChI | InChI=1S/C23H25N3/c1-18-10-12-25-14-15-26-13-11-20(17-23(26)22(25)16-18)5-4-19-6-8-21(9-7-19)24(2)3/h4-13,16-17H,14-15H2,1-3H3/q+2 |
| InChIKey | VEPLKHDXZVRBHS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|