C34H31N3+2 — CID 123227697
6-[2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine (PubChem CID 123227697) has the molecular formula C34H31N3+2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 6-[2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine.
| Compound Name | 6-[2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 123227697 |
| Molecular Formula | C34H31N3+2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 6-[2-(8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaen-5-yl)ethenyl]-N,N-dimethylnaphthalen-2-amine |
| SMILES | CN(C)c1ccc2cc(C=Cc3cc[n+]4c(c3)-c3c(ccc5c3-c3cccc[n+]3CC5)CC4)ccc2c1 |
| InChI | InChI=1S/C34H31N3/c1-35(2)30-13-12-28-21-24(8-9-29(28)23-30)6-7-25-14-18-37-20-16-27-11-10-26-15-19-36-17-4-3-5-31(36)33(26)34(27)32(37)22-25/h3-14,17-18,21-23H,15-16,19-20H2,1-2H3/q+2 |
| InChIKey | GAJTYHPPPCPTPR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|