C30H24N4O2+2 — CID 126738802
5-[(E)-2-(4-nitro-1H-indol-3-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene (PubChem CID 126738802) has the molecular formula C30H24N4O2+2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 5-[(E)-2-(4-nitro-1H-indol-3-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene.
| Compound Name | 5-[(E)-2-(4-nitro-1H-indol-3-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene |
|---|---|
| PubChem CID | 126738802 |
| Molecular Formula | C30H24N4O2+2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 5-[(E)-2-(4-nitro-1H-indol-3-yl)ethenyl]-8,17-diazoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3(8),4,6,12,17,19,21-nonaene |
| SMILES | O=[N+]([O-])c1cccc2[nH]cc(/C=C/c3cc[n+]4c(c3)-c3c(ccc5c3-c3cccc[n+]3CC5)CC4)c12 |
| InChI | InChI=1S/C30H23N4O2/c35-34(36)26-6-3-4-24-28(26)23(19-31-24)8-7-20-11-15-33-17-13-22-10-9-21-12-16-32-14-2-1-5-25(32)29(21)30(22)27(33)18-20/h1-11,14-15,18-19H,12-13,16-17H2/q+1/p+1 |
| InChIKey | GODBIQHTBGTNEQ-UHFFFAOYSA-O |
| XLogP | 5.27 |
| TPSA | 66.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|