C22H18N2O6 — CID 68555325
(1E,6E)-1-(3-hydroxy-4-methoxyphenyl)-7-(4-nitro-1H-indol-3-yl)hepta-1,6-diene-3,5-dione (PubChem CID 68555325) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is (1E,6E)-1-(3-hydroxy-4-methoxyphenyl)-7-(4-nitro-1H-indol-3-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(3-hydroxy-4-methoxyphenyl)-7-(4-nitro-1H-indol-3-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68555325 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (1E,6E)-1-(3-hydroxy-4-methoxyphenyl)-7-(4-nitro-1H-indol-3-yl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2c[nH]c3cccc([N+](=O)[O-])c23)cc1O |
| InChI | InChI=1S/C22H18N2O6/c1-30-21-10-6-14(11-20(21)27)5-8-16(25)12-17(26)9-7-15-13-23-18-3-2-4-19(22(15)18)24(28)29/h2-11,13,23,27H,12H2,1H3/b8-5+,9-7+ |
| InChIKey | TXBZBYOJNYBQIT-OCIXRKKMSA-N |
| XLogP | 4.05 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|