C19H16BrN — CID 159477662
(1E)-1-(naphthalen-2-ylmethylidene)-2,3-dihydroindolizin-4-ium bromide (PubChem CID 159477662) has the molecular formula C19H16BrN and a molecular weight of 338.25 g/mol. Its IUPAC name is (1E)-1-(naphthalen-2-ylmethylidene)-2,3-dihydroindolizin-4-ium bromide.
| Compound Name | (1E)-1-(naphthalen-2-ylmethylidene)-2,3-dihydroindolizin-4-ium bromide |
|---|---|
| PubChem CID | 159477662 |
| Molecular Formula | C19H16BrN |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (1E)-1-(naphthalen-2-ylmethylidene)-2,3-dihydroindolizin-4-ium bromide |
| SMILES | C(=C1\CC[n+]2ccccc21)\c1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C19H16N.BrH/c1-2-6-17-13-15(8-9-16(17)5-1)14-18-10-12-20-11-4-3-7-19(18)20;/h1-9,11,13-14H,10,12H2;1H/q+1;/p-1/b18-14+; |
| InChIKey | WWSMKVJJLHRGFU-LSJACRKWSA-M |
| XLogP | 1.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|