C20H16 — CID 54058053
2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]naphthalene (PubChem CID 54058053) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]naphthalene.
| Compound Name | 2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 54058053 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]naphthalene |
| SMILES | C(=Cc1ccc2ccccc2c1)c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C20H16/c1-2-4-19-13-15(7-9-17(19)3-1)5-6-16-8-10-18-11-12-20(18)14-16/h1-10,13-14H,11-12H2 |
| InChIKey | LXRFKBRFXLQNBS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|