C33H28N2O+2 — CID 123265167
5-[2-(4-methoxyphenyl)ethenyl]-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene (PubChem CID 123265167) has the molecular formula C33H28N2O+2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethenyl]-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene.
| Compound Name | 5-[2-(4-methoxyphenyl)ethenyl]-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene |
|---|---|
| PubChem CID | 123265167 |
| Molecular Formula | C33H28N2O+2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethenyl]-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene |
| SMILES | COc1ccc(C=Cc2cc[n+]3c(c2)-c2c(ccc4c2-c2c5ccccc5cc[n+]2CC4)CC3)cc1 |
| InChI | InChI=1S/C33H28N2O/c1-36-28-12-8-23(9-13-28)6-7-24-14-18-34-19-16-26-10-11-27-17-21-35-20-15-25-4-2-3-5-29(25)33(35)32(27)31(26)30(34)22-24/h2-15,18,20,22H,16-17,19,21H2,1H3/q+2 |
| InChIKey | NTRIXFQQPKBICR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|