C36H30BrN3+2 — CID 126738819
5-[(E)-2-(5-bromo-1H-indol-3-yl)ethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene (PubChem CID 126738819) has the molecular formula C36H30BrN3+2 and a molecular weight of 584.56 g/mol. Its IUPAC name is 5-[(E)-2-(5-bromo-1H-indol-3-yl)ethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene.
| Compound Name | 5-[(E)-2-(5-bromo-1H-indol-3-yl)ethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene |
|---|---|
| PubChem CID | 126738819 |
| Molecular Formula | C36H30BrN3+2 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 5-[(E)-2-(5-bromo-1H-indol-3-yl)ethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene |
| SMILES | Cc1c(C)c2c(c3c1CC[n+]1ccc(/C=C/c4c[nH]c5ccc(Br)cc45)cc1-3)-c1c3ccccc3cc[n+]1CC2 |
| InChI | InChI=1S/C36H29BrN3/c1-22-23(2)29-14-18-40-16-12-25-5-3-4-6-30(25)36(40)35(29)34-28(22)13-17-39-15-11-24(19-33(34)39)7-8-26-21-38-32-10-9-27(37)20-31(26)32/h3-12,15-16,19-21H,13-14,17-18H2,1-2H3/q+1/p+1 |
| InChIKey | PLLITZQFHJINNO-UHFFFAOYSA-O |
| XLogP | 7.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|