C27H26I2N2 — CID 139185710
5,12,13-trimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene diiodide (PubChem CID 139185710) has the molecular formula C27H26I2N2 and a molecular weight of 632.33 g/mol. Its IUPAC name is 5,12,13-trimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene diiodide.
| Compound Name | 5,12,13-trimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene diiodide |
|---|---|
| PubChem CID | 139185710 |
| Molecular Formula | C27H26I2N2 |
| Molecular Weight | 632.33 g/mol |
| Exact Mass | 632.02 |
| IUPAC Name | 5,12,13-trimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3(8),4,6,12,17(26),18,20,22,24-undecaene diiodide |
| SMILES | Cc1cc[n+]2c(c1)-c1c(c(C)c(C)c3c1-c1c4ccccc4cc[n+]1CC3)CC2.[I-].[I-] |
| InChI | InChI=1S/C27H26N2.2HI/c1-17-8-12-28-14-10-21-18(2)19(3)22-11-15-29-13-9-20-6-4-5-7-23(20)27(29)26(22)25(21)24(28)16-17;;/h4-9,12-13,16H,10-11,14-15H2,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | GWVFBACQDQNVDK-UHFFFAOYSA-L |
| XLogP | -1.21 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.33 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|