C26H26F6N2O6S2 — CID 139185714
5,22-dimethyl-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3(8),4,6,13,19(24),20,22-nonaene;bis(trifluoromethanesulfonate) (PubChem CID 139185714) has the molecular formula C26H26F6N2O6S2 and a molecular weight of 640.62 g/mol. Its IUPAC name is 5,22-dimethyl-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3(8),4,6,13,19(24),20,22-nonaene;bis(trifluoromethanesulfonate).
| Compound Name | 5,22-dimethyl-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3(8),4,6,13,19(24),20,22-nonaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139185714 |
| Molecular Formula | C26H26F6N2O6S2 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | 5,22-dimethyl-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3(8),4,6,13,19(24),20,22-nonaene;bis(trifluoromethanesulfonate) |
| SMILES | Cc1cc[n+]2c(c1)-c1c(ccc3c1-c1cc(C)cc[n+]1CCC3)CCC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H26N2.2CHF3O3S/c1-17-9-13-25-11-3-5-19-7-8-20-6-4-12-26-14-10-18(2)16-22(26)24(20)23(19)21(25)15-17;2*2-1(3,4)8(5,6)7/h7-10,13-16H,3-6,11-12H2,1-2H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | FLBPNYKAPKILTD-UHFFFAOYSA-L |
| XLogP | 4.21 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|