C22H23N2+ — CID 118545985
2-methyl-10-propyl-11-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium (PubChem CID 118545985) has the molecular formula C22H23N2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-methyl-10-propyl-11-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium.
| Compound Name | 2-methyl-10-propyl-11-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 118545985 |
| Molecular Formula | C22H23N2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-methyl-10-propyl-11-pyridin-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium |
| SMILES | CCCc1ccc2c(c1-c1ccccn1)-c1cc(C)cc[n+]1CC2 |
| InChI | InChI=1S/C22H23N2/c1-3-6-17-8-9-18-11-14-24-13-10-16(2)15-20(24)22(18)21(17)19-7-4-5-12-23-19/h4-5,7-10,12-13,15H,3,6,11,14H2,1-2H3/q+1 |
| InChIKey | QMXAWQCUGRCLFG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|