C19H24ClN — CID 160991399
2-(2,6-dibutyl-4-chlorophenyl)pyridine (PubChem CID 160991399) has the molecular formula C19H24ClN and a molecular weight of 301.86 g/mol. Its IUPAC name is 2-(2,6-dibutyl-4-chlorophenyl)pyridine.
| Compound Name | 2-(2,6-dibutyl-4-chlorophenyl)pyridine |
|---|---|
| PubChem CID | 160991399 |
| Molecular Formula | C19H24ClN |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(2,6-dibutyl-4-chlorophenyl)pyridine |
| SMILES | CCCCc1cc(Cl)cc(CCCC)c1-c1ccccn1 |
| InChI | InChI=1S/C19H24ClN/c1-3-5-9-15-13-17(20)14-16(10-6-4-2)19(15)18-11-7-8-12-21-18/h7-8,11-14H,3-6,9-10H2,1-2H3 |
| InChIKey | TURHMQLUJYHPLF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |