C18H18N4 — CID 6418950
4-butyl-3,6-dipyridin-2-ylpyridazine (PubChem CID 6418950) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-butyl-3,6-dipyridin-2-ylpyridazine.
| Compound Name | 4-butyl-3,6-dipyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 6418950 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-butyl-3,6-dipyridin-2-ylpyridazine |
| SMILES | CCCCc1cc(-c2ccccn2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C18H18N4/c1-2-3-8-14-13-17(15-9-4-6-11-19-15)21-22-18(14)16-10-5-7-12-20-16/h4-7,9-13H,2-3,8H2,1H3 |
| InChIKey | VKNIEPOJYRWEMO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |