C15H11N4OP — CID 122674343
4-(phosphorosomethyl)-3,6-dipyridin-2-ylpyridazine (PubChem CID 122674343) has the molecular formula C15H11N4OP and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-(phosphorosomethyl)-3,6-dipyridin-2-ylpyridazine.
| Compound Name | 4-(phosphorosomethyl)-3,6-dipyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 122674343 |
| Molecular Formula | C15H11N4OP |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-(phosphorosomethyl)-3,6-dipyridin-2-ylpyridazine |
| SMILES | O=PCc1cc(-c2ccccn2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C15H11N4OP/c20-21-10-11-9-14(12-5-1-3-7-16-12)18-19-15(11)13-6-2-4-8-17-13/h1-9H,10H2 |
| InChIKey | CBKMCWFKOZEBNU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|