C20H22N4 — CID 58250586
4,5-dipropyl-3,6-dipyridin-2-ylpyridazine (PubChem CID 58250586) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4,5-dipropyl-3,6-dipyridin-2-ylpyridazine.
| Compound Name | 4,5-dipropyl-3,6-dipyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 58250586 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4,5-dipropyl-3,6-dipyridin-2-ylpyridazine |
| SMILES | CCCc1c(-c2ccccn2)nnc(-c2ccccn2)c1CCC |
| InChI | InChI=1S/C20H22N4/c1-3-9-15-16(10-4-2)20(18-12-6-8-14-22-18)24-23-19(15)17-11-5-7-13-21-17/h5-8,11-14H,3-4,9-10H2,1-2H3 |
| InChIKey | QSRHJZRHHCFUMB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |