About 2-chloro-3-hexylpyridine
2-chloro-3-hexylpyridine (PubChem CID 54056214) has the molecular formula C11H16ClN
and a molecular weight of 197.71 g/mol. Its IUPAC name is 2-chloro-3-hexylpyridine.
Molecular Properties
| Compound Name | 2-chloro-3-hexylpyridine |
| PubChem CID | 54056214 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-chloro-3-hexylpyridine |
| SMILES | CCCCCCc1cccnc1Cl |
| InChI | InChI=1S/C11H16ClN/c1-2-3-4-5-7-10-8-6-9-13-11(10)12/h6,8-9H,2-5,7H2,1H3 |
| InChIKey | WBFCRXLWSGGLFF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-hexylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-hexylpyridine?
The IUPAC name of 2-chloro-3-hexylpyridine (CID 54056214) is 2-chloro-3-hexylpyridine.
What is the SMILES notation for 2-chloro-3-hexylpyridine?
The canonical SMILES for 2-chloro-3-hexylpyridine is CCCCCCc1cccnc1Cl.
What is the InChIKey of 2-chloro-3-hexylpyridine?
The InChIKey is WBFCRXLWSGGLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN/c1-2-3-4-5-7-10-8-6-9-13-11(10)12/h6,8-9H,2-5,7H2,1H3.
What are the key properties of 2-chloro-3-hexylpyridine?
2-chloro-3-hexylpyridine has a molecular weight of 197.71 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-hexylpyridine is sourced from PubChem (CID 54056214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).