C17H21NO3 — CID 173295109
2-(2,3,4-trimethoxy-5-propylphenyl)pyridine (PubChem CID 173295109) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(2,3,4-trimethoxy-5-propylphenyl)pyridine.
| Compound Name | 2-(2,3,4-trimethoxy-5-propylphenyl)pyridine |
|---|---|
| PubChem CID | 173295109 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-(2,3,4-trimethoxy-5-propylphenyl)pyridine |
| SMILES | CCCc1cc(-c2ccccn2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C17H21NO3/c1-5-8-12-11-13(14-9-6-7-10-18-14)16(20-3)17(21-4)15(12)19-2/h6-7,9-11H,5,8H2,1-4H3 |
| InChIKey | LNGRAOTYMNIKDY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |