About 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol
5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol (PubChem CID 5207280) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol.
Molecular Properties
| Compound Name | 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol |
| PubChem CID | 5207280 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol |
| SMILES | CCCc1cc(-c2oncc2-c2ccccn2)c(O)cc1OC |
| InChI | InChI=1S/C18H18N2O3/c1-3-6-12-9-13(16(21)10-17(12)22-2)18-14(11-20-23-18)15-7-4-5-8-19-15/h4-5,7-11,21H,3,6H2,1-2H3 |
| InChIKey | VTFDZXNMWBNNAV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol?
The IUPAC name of 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol (CID 5207280) is 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol.
What is the SMILES notation for 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol?
The canonical SMILES for 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol is CCCc1cc(-c2oncc2-c2ccccn2)c(O)cc1OC.
What is the InChIKey of 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol?
The InChIKey is VTFDZXNMWBNNAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3/c1-3-6-12-9-13(16(21)10-17(12)22-2)18-14(11-20-23-18)15-7-4-5-8-19-15/h4-5,7-11,21H,3,6H2,1-2H3.
What are the key properties of 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol?
5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol has a molecular weight of 310.35 g/mol, XLogP of 4.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4-propyl-2-(4-pyridin-2-yl-1,2-oxazol-5-yl)phenol is sourced from PubChem (CID 5207280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).