C21H17N3O — CID 21024858
8-methoxy-2-methyl-5,7-dipyridin-2-ylquinoline (PubChem CID 21024858) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 8-methoxy-2-methyl-5,7-dipyridin-2-ylquinoline.
| Compound Name | 8-methoxy-2-methyl-5,7-dipyridin-2-ylquinoline |
|---|---|
| PubChem CID | 21024858 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 8-methoxy-2-methyl-5,7-dipyridin-2-ylquinoline |
| SMILES | COc1c(-c2ccccn2)cc(-c2ccccn2)c2ccc(C)nc12 |
| InChI | InChI=1S/C21H17N3O/c1-14-9-10-15-16(18-7-3-5-11-22-18)13-17(19-8-4-6-12-23-19)21(25-2)20(15)24-14/h3-13H,1-2H3 |
| InChIKey | PKBJSYRZFREFRV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |