C40H32N2O+2 — CID 126738855
7-[(E)-2-dibenzofuran-4-ylethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3,5,7,12,17(26),18,20,22,24-undecaene (PubChem CID 126738855) has the molecular formula C40H32N2O+2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 7-[(E)-2-dibenzofuran-4-ylethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3,5,7,12,17(26),18,20,22,24-undecaene.
| Compound Name | 7-[(E)-2-dibenzofuran-4-ylethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3,5,7,12,17(26),18,20,22,24-undecaene |
|---|---|
| PubChem CID | 126738855 |
| Molecular Formula | C40H32N2O+2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 7-[(E)-2-dibenzofuran-4-ylethenyl]-12,13-dimethyl-8,17-diazoniahexacyclo[12.12.0.02,11.03,8.017,26.020,25]hexacosa-1(14),2(11),3,5,7,12,17(26),18,20,22,24-undecaene |
| SMILES | Cc1c(C)c2c(c3c1CC[n+]1ccc4ccccc4c1-3)-c1cccc(/C=C/c3cccc4c3oc3ccccc34)[n+]1CC2 |
| InChI | InChI=1S/C40H32N2O/c1-25-26(2)31-20-23-41-22-19-27-9-3-4-12-32(27)39(41)38(31)37-30(25)21-24-42-29(11-8-15-35(37)42)18-17-28-10-7-14-34-33-13-5-6-16-36(33)43-40(28)34/h3-19,22H,20-21,23-24H2,1-2H3/q+2/b18-17+ |
| InChIKey | DPNSLCJMAUHJCT-ISLYRVAYSA-N |
| XLogP | 8.55 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|