C30H30N2O8P2 — CID 71567984
bis(dihydrogen phosphate);16,17-dimethyl-12,21-diazoniaheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3(12),4,6,8,10,16,21(30),22,24,26,28-tridecaene (PubChem CID 71567984) has the molecular formula C30H30N2O8P2 and a molecular weight of 608.52 g/mol. Its IUPAC name is bis(dihydrogen phosphate);16,17-dimethyl-12,21-diazoniaheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3(12),4,6,8,10,16,21(30),22,24,26,28-tridecaene.
| Compound Name | bis(dihydrogen phosphate);16,17-dimethyl-12,21-diazoniaheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3(12),4,6,8,10,16,21(30),22,24,26,28-tridecaene |
|---|---|
| PubChem CID | 71567984 |
| Molecular Formula | C30H30N2O8P2 |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | bis(dihydrogen phosphate);16,17-dimethyl-12,21-diazoniaheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3(12),4,6,8,10,16,21(30),22,24,26,28-tridecaene |
| SMILES | Cc1c(C)c2c(c3c1CC[n+]1ccc4ccccc4c1-3)-c1c3ccccc3cc[n+]1CC2.O=P([O-])(O)O.O=P([O-])(O)O |
| InChI | InChI=1S/C30H26N2.2H3O4P/c1-19-20(2)24-14-18-32-16-12-22-8-4-6-10-26(22)30(32)28(24)27-23(19)13-17-31-15-11-21-7-3-5-9-25(21)29(27)31;2*1-5(2,3)4/h3-12,15-16H,13-14,17-18H2,1-2H3;2*(H3,1,2,3,4)/q+2;;/p-2 |
| InChIKey | LPBSKJXDEQEQBO-UHFFFAOYSA-L |
| XLogP | 2.51 |
| TPSA | 168.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|