C40H39N3+2 — CID 118545038
26-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene (PubChem CID 118545038) has the molecular formula C40H39N3+2 and a molecular weight of 561.77 g/mol. Its IUPAC name is 26-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene.
| Compound Name | 26-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene |
|---|---|
| PubChem CID | 118545038 |
| Molecular Formula | C40H39N3+2 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 26-[(E)-2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene |
| SMILES | C(=C/c1cc2[n+](c3ccccc13)CCCc1ccc3c(c1-2)-c1cccc[n+]1CCC3)\c1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C40H39N3/c1-2-14-35-34(13-1)31(17-16-28-25-32-11-6-22-42-23-7-12-33(26-28)40(32)42)27-37-39-30(10-8-24-43(35)37)19-18-29-9-5-21-41-20-4-3-15-36(41)38(29)39/h1-4,13-20,25-27H,5-12,21-24H2/q+2 |
| InChIKey | OYGRWGNZLQXJEX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|