C40H33N3+2 — CID 126738847
27-[(E)-2-(1H-benzo[g]indol-3-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene (PubChem CID 126738847) has the molecular formula C40H33N3+2 and a molecular weight of 555.73 g/mol. Its IUPAC name is 27-[(E)-2-(1H-benzo[g]indol-3-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene.
| Compound Name | 27-[(E)-2-(1H-benzo[g]indol-3-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene |
|---|---|
| PubChem CID | 126738847 |
| Molecular Formula | C40H33N3+2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 27-[(E)-2-(1H-benzo[g]indol-3-yl)ethenyl]-8,19-diazoniahexacyclo[13.13.0.02,12.03,8.019,28.020,25]octacosa-1(15),2(12),3,5,7,13,19(28),20,22,24,26-undecaene |
| SMILES | C(=C/c1c[nH]c2c1ccc1ccccc12)\c1cc2ccccc2[n+]2c1-c1c(ccc3c1-c1cccc[n+]1CCC3)CCC2 |
| InChI | InChI=1S/C40H32N3/c1-3-13-33-27(9-1)20-21-34-32(26-41-39(33)34)19-18-31-25-30-10-2-4-14-35(30)43-24-8-12-29-17-16-28-11-7-23-42-22-6-5-15-36(42)37(28)38(29)40(31)43/h1-6,9-10,13-22,25-26H,7-8,11-12,23-24H2/q+1/p+1 |
| InChIKey | KJMJQWCFNKKQMG-UHFFFAOYSA-O |
| XLogP | 8.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|