C43H59N4S2+ — CID 143547033
4-[(E)-2-[1-[6-[6-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyldisulfanyl]hexyl]-2-methyl-2H-pyridin-6-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 143547033) has the molecular formula C43H59N4S2+ and a molecular weight of 696.11 g/mol. Its IUPAC name is 4-[(E)-2-[1-[6-[6-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyldisulfanyl]hexyl]-2-methyl-2H-pyridin-6-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[1-[6-[6-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyldisulfanyl]hexyl]-2-methyl-2H-pyridin-6-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 143547033 |
| Molecular Formula | C43H59N4S2+ |
| Molecular Weight | 696.11 g/mol |
| Exact Mass | 695.42 |
| IUPAC Name | 4-[(E)-2-[1-[6-[6-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexyldisulfanyl]hexyl]-2-methyl-2H-pyridin-6-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CC1C=CC=C(/C=C/c2ccc(N(C)C)cc2)N1CCCCCCSSCCCCCC[n+]1ccccc1/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C43H59N4S2/c1-37-17-16-19-43(31-25-39-22-28-41(29-23-39)45(4)5)47(37)34-12-7-9-15-36-49-48-35-14-8-6-11-32-46-33-13-10-18-42(46)30-24-38-20-26-40(27-21-38)44(2)3/h10,13,16-31,33,37H,6-9,11-12,14-15,32,34-36H2,1-5H3/q+1/b31-25+ |
| InChIKey | GPDJLJDDTDOBIW-QCKNELIISA-N |
| XLogP | 10.64 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.11 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|