C23H26N3O+ — CID 177479244
4-[(E)-2-[1-[2-(4-aminophenoxy)ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 177479244) has the molecular formula C23H26N3O+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-[(E)-2-[1-[2-(4-aminophenoxy)ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[1-[2-(4-aminophenoxy)ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 177479244 |
| Molecular Formula | C23H26N3O+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-[(E)-2-[1-[2-(4-aminophenoxy)ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cccc[n+]2CCOc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C23H26N3O/c1-25(2)21-11-6-19(7-12-21)8-13-22-5-3-4-16-26(22)17-18-27-23-14-9-20(24)10-15-23/h3-16H,17-18,24H2,1-2H3/q+1 |
| InChIKey | LRRWTNZKAUHWEG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|