C36H46N4S2+2 — CID 140586710
4-[(E)-2-(1-ethyl-1,2-dihydropyridin-1-ium-6-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]ethyldisulfanyl]ethyl]-N-methylaniline (PubChem CID 140586710) has the molecular formula C36H46N4S2+2 and a molecular weight of 598.93 g/mol. Its IUPAC name is 4-[(E)-2-(1-ethyl-1,2-dihydropyridin-1-ium-6-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]ethyldisulfanyl]ethyl]-N-methylaniline.
| Compound Name | 4-[(E)-2-(1-ethyl-1,2-dihydropyridin-1-ium-6-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]ethyldisulfanyl]ethyl]-N-methylaniline |
|---|---|
| PubChem CID | 140586710 |
| Molecular Formula | C36H46N4S2+2 |
| Molecular Weight | 598.93 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 4-[(E)-2-(1-ethyl-1,2-dihydropyridin-1-ium-6-yl)ethenyl]-N-[2-[2-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]-N-methylanilino]ethyldisulfanyl]ethyl]-N-methylaniline |
| SMILES | CC[n+]1ccccc1/C=C/c1ccc(N(C)CCSSCCN(C)c2ccc(/C=C/C3=CC=CC[NH+]3CC)cc2)cc1 |
| InChI | InChI=1S/C36H45N4S2/c1-5-39-25-9-7-11-35(39)23-17-31-13-19-33(20-14-31)37(3)27-29-41-42-30-28-38(4)34-21-15-32(16-22-34)18-24-36-12-8-10-26-40(36)6-2/h7-25H,5-6,26-30H2,1-4H3/q+1/p+1/b24-18+ |
| InChIKey | RQKOKSSDNLEUAQ-HKOYGPOVSA-O |
| XLogP | 6.49 |
| TPSA | 14.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.93 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|