C30H39N2O6+ — CID 102532102
3-[4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-amine (PubChem CID 102532102) has the molecular formula C30H39N2O6+ and a molecular weight of 523.65 g/mol. Its IUPAC name is 3-[4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-amine.
| Compound Name | 3-[4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 102532102 |
| Molecular Formula | C30H39N2O6+ |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 3-[4-[(E)-2-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]quinolin-1-ium-1-yl]propan-1-amine |
| SMILES | NCCC[n+]1ccc(/C=C/c2ccc3c(c2)OCCOCCOCCOCCOCCO3)c2ccccc21 |
| InChI | InChI=1S/C30H39N2O6/c31-11-3-12-32-13-10-26(27-4-1-2-5-28(27)32)8-6-25-7-9-29-30(24-25)38-23-21-36-19-17-34-15-14-33-16-18-35-20-22-37-29/h1-2,4-10,13,24H,3,11-12,14-23,31H2/q+1/b8-6+ |
| InChIKey | AGMPOXBWJAKVBF-SOFGYWHQSA-N |
| XLogP | 3.48 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|