C32H33NO8S — CID 177410094
4-[[4-[(Z)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]quinolin-1-ium-1-yl]methyl]benzenesulfonate (PubChem CID 177410094) has the molecular formula C32H33NO8S and a molecular weight of 591.68 g/mol. Its IUPAC name is 4-[[4-[(Z)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]quinolin-1-ium-1-yl]methyl]benzenesulfonate.
| Compound Name | 4-[[4-[(Z)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]quinolin-1-ium-1-yl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 177410094 |
| Molecular Formula | C32H33NO8S |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 4-[[4-[(Z)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]quinolin-1-ium-1-yl]methyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C[n+]2ccc(/C=C\c3ccc4c(c3)OCCOCCOCCOCCO4)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H33NO8S/c34-42(35,36)28-10-6-26(7-11-28)24-33-14-13-27(29-3-1-2-4-30(29)33)9-5-25-8-12-31-32(23-25)41-22-20-39-18-16-37-15-17-38-19-21-40-31/h1-14,23H,15-22,24H2/b9-5- |
| InChIKey | MHOLTHXAJPADOG-UITAMQMPSA-N |
| XLogP | 4.07 |
| TPSA | 107.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|