C18H19NO4S — CID 110712195
N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]benzenesulfonamide (PubChem CID 110712195) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]benzenesulfonamide.
| Compound Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110712195 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC/C=C/c1ccc2c(c1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C18H19NO4S/c20-24(21,16-7-2-1-3-8-16)19-11-5-4-6-15-9-10-17-18(14-15)23-13-12-22-17/h1-4,6-10,14,19H,5,11-13H2/b6-4+ |
| InChIKey | PEVSNIFXDDHRCL-GQCTYLIASA-N |
| XLogP | 2.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|