C17H23NO3 — CID 110712161
N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3-methylbutanamide (PubChem CID 110712161) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3-methylbutanamide.
| Compound Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 110712161 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NCC/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-13(2)11-17(19)18-8-4-3-5-14-6-7-15-16(12-14)21-10-9-20-15/h3,5-7,12-13H,4,8-11H2,1-2H3,(H,18,19)/b5-3+ |
| InChIKey | ZEXCTVFUIFIBGB-HWKANZROSA-N |
| XLogP | 3.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|