C15H21NO4S — CID 110712192
N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]propane-1-sulfonamide (PubChem CID 110712192) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]propane-1-sulfonamide.
| Compound Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 110712192 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCC/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H21NO4S/c1-2-11-21(17,18)16-8-4-3-5-13-6-7-14-15(12-13)20-10-9-19-14/h3,5-7,12,16H,2,4,8-11H2,1H3/b5-3+ |
| InChIKey | NPJMAVCQRZVYGV-HWKANZROSA-N |
| XLogP | 2.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|