C15H19NO5S — CID 75363423
(E)-N-butylsulfonyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide (PubChem CID 75363423) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is (E)-N-butylsulfonyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide.
| Compound Name | (E)-N-butylsulfonyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75363423 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (E)-N-butylsulfonyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
| SMILES | CCCCS(=O)(=O)NC(=O)/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H19NO5S/c1-2-3-10-22(18,19)16-15(17)7-5-12-4-6-13-14(11-12)21-9-8-20-13/h4-7,11H,2-3,8-10H2,1H3,(H,16,17)/b7-5+ |
| InChIKey | ACXPOLBUCPUIFF-FNORWQNLSA-N |
| XLogP | 1.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|